C20H18Cl3N3O3 — CID 139385138
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(3-methoxyazetidin-1-yl)-2,6-naphthyridine (PubChem CID 139385138) has the molecular formula C20H18Cl3N3O3 and a molecular weight of 454.74 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(3-methoxyazetidin-1-yl)-2,6-naphthyridine.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(3-methoxyazetidin-1-yl)-2,6-naphthyridine |
|---|---|
| PubChem CID | 139385138 |
| Molecular Formula | C20H18Cl3N3O3 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-(3-methoxyazetidin-1-yl)-2,6-naphthyridine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3c(N3CC(OC)C3)n2)c1Cl |
| InChI | InChI=1S/C20H18Cl3N3O3/c1-27-11-8-26(9-11)20-12-5-16(21)24-7-10(12)4-13(25-20)17-18(22)14(28-2)6-15(29-3)19(17)23/h4-7,11H,8-9H2,1-3H3 |
| InChIKey | YKYKCJVKMMFPLR-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|