C20H18ClF2N3O2 — CID 139385182
7-chloro-N-(cyclopropylmethyl)-3-(2,6-difluoro-3,5-dimethoxyphenyl)-2,6-naphthyridin-1-amine (PubChem CID 139385182) has the molecular formula C20H18ClF2N3O2 and a molecular weight of 405.83 g/mol. Its IUPAC name is 7-chloro-N-(cyclopropylmethyl)-3-(2,6-difluoro-3,5-dimethoxyphenyl)-2,6-naphthyridin-1-amine.
| Compound Name | 7-chloro-N-(cyclopropylmethyl)-3-(2,6-difluoro-3,5-dimethoxyphenyl)-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 139385182 |
| Molecular Formula | C20H18ClF2N3O2 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 7-chloro-N-(cyclopropylmethyl)-3-(2,6-difluoro-3,5-dimethoxyphenyl)-2,6-naphthyridin-1-amine |
| SMILES | COc1cc(OC)c(F)c(-c2cc3cnc(Cl)cc3c(NCC3CC3)n2)c1F |
| InChI | InChI=1S/C20H18ClF2N3O2/c1-27-14-7-15(28-2)19(23)17(18(14)22)13-5-11-9-24-16(21)6-12(11)20(26-13)25-8-10-3-4-10/h5-7,9-10H,3-4,8H2,1-2H3,(H,25,26) |
| InChIKey | DUKHOTPCGVDBQH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|