C27H29F2N5O4 — CID 139385195
N-[(3R,4S)-4-[[5-(cyclopropylmethylamino)-7-[2,6-difluoro-3,5-bis(trideuteriomethoxy)phenyl]-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 139385195) has the molecular formula C27H29F2N5O4 and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[5-(cyclopropylmethylamino)-7-[2,6-difluoro-3,5-bis(trideuteriomethoxy)phenyl]-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[5-(cyclopropylmethylamino)-7-[2,6-difluoro-3,5-bis(trideuteriomethoxy)phenyl]-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139385195 |
| Molecular Formula | C27H29F2N5O4 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | N-[(3R,4S)-4-[[5-(cyclopropylmethylamino)-7-[2,6-difluoro-3,5-bis(trideuteriomethoxy)phenyl]-2,6-naphthyridin-3-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | [2H]C([2H])([2H])Oc1cc(OC([2H])([2H])[2H])c(F)c(-c2cc3cnc(N[C@@H]4COC[C@@H]4NC(=O)C=C)cc3c(NCC3CC3)n2)c1F |
| InChI | InChI=1S/C27H29F2N5O4/c1-4-23(35)33-19-13-38-12-18(19)32-22-8-16-15(11-30-22)7-17(34-27(16)31-10-14-5-6-14)24-25(28)20(36-2)9-21(37-3)26(24)29/h4,7-9,11,14,18-19H,1,5-6,10,12-13H2,2-3H3,(H,30,32)(H,31,34)(H,33,35)/t18-,19+/m1/s1/i2D3,3D3 |
| InChIKey | HBLSUPKFELCWBU-OUZZMSHJSA-N |
| XLogP | 3.90 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|