C21H18Cl3N5O2 — CID 139385381
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-[(1-methylpyrazol-4-yl)methyl]-2,6-naphthyridin-1-amine (PubChem CID 139385381) has the molecular formula C21H18Cl3N5O2 and a molecular weight of 478.77 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-[(1-methylpyrazol-4-yl)methyl]-2,6-naphthyridin-1-amine.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-[(1-methylpyrazol-4-yl)methyl]-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 139385381 |
| Molecular Formula | C21H18Cl3N5O2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-[(1-methylpyrazol-4-yl)methyl]-2,6-naphthyridin-1-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3c(NCc3cnn(C)c3)n2)c1Cl |
| InChI | InChI=1S/C21H18Cl3N5O2/c1-29-10-11(8-27-29)7-26-21-13-5-17(22)25-9-12(13)4-14(28-21)18-19(23)15(30-2)6-16(31-3)20(18)24/h4-6,8-10H,7H2,1-3H3,(H,26,28) |
| InChIKey | HIQRBLXBRIOSRY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|