C20H16Cl3F2N3O2 — CID 139385396
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(3,3-difluorocyclobutyl)-2,6-naphthyridin-1-amine (PubChem CID 139385396) has the molecular formula C20H16Cl3F2N3O2 and a molecular weight of 474.72 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(3,3-difluorocyclobutyl)-2,6-naphthyridin-1-amine.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(3,3-difluorocyclobutyl)-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 139385396 |
| Molecular Formula | C20H16Cl3F2N3O2 |
| Molecular Weight | 474.72 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(3,3-difluorocyclobutyl)-2,6-naphthyridin-1-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3c(NC3CC(F)(F)C3)n2)c1Cl |
| InChI | InChI=1S/C20H16Cl3F2N3O2/c1-29-13-5-14(30-2)18(23)16(17(13)22)12-3-9-8-26-15(21)4-11(9)19(28-12)27-10-6-20(24,25)7-10/h3-5,8,10H,6-7H2,1-2H3,(H,27,28) |
| InChIKey | SQKGOBFXMHMIAK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.72 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|