About 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine
3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine (PubChem CID 139385472) has the molecular formula C19H18Cl2N2O2
and a molecular weight of 377.27 g/mol. Its IUPAC name is 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine.
Molecular Properties
| Compound Name | 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine |
| PubChem CID | 139385472 |
| Molecular Formula | C19H18Cl2N2O2 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine |
| SMILES | COc1cc(OC)c(C(C)C)c(-c2cc3cnc(Cl)cc3cn2)c1Cl |
| InChI | InChI=1S/C19H18Cl2N2O2/c1-10(2)17-14(24-3)7-15(25-4)19(21)18(17)13-5-11-9-23-16(20)6-12(11)8-22-13/h5-10H,1-4H3 |
| InChIKey | TYFUQNIUIZIYRK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine?
The IUPAC name of 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine (CID 139385472) is 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine.
What is the SMILES notation for 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine?
The canonical SMILES for 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine is COc1cc(OC)c(C(C)C)c(-c2cc3cnc(Cl)cc3cn2)c1Cl.
What is the InChIKey of 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine?
The InChIKey is TYFUQNIUIZIYRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2N2O2/c1-10(2)17-14(24-3)7-15(25-4)19(21)18(17)13-5-11-9-23-16(20)6-12(11)8-22-13/h5-10H,1-4H3.
What are the key properties of 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine?
3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine has a molecular weight of 377.27 g/mol, XLogP of 5.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-7-(2-chloro-3,5-dimethoxy-6-propan-2-ylphenyl)-2,6-naphthyridine is sourced from PubChem (CID 139385472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).