C21H18Cl3F2N3O2 — CID 139385498
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(3,3-difluorocyclopentyl)-2,6-naphthyridin-1-amine (PubChem CID 139385498) has the molecular formula C21H18Cl3F2N3O2 and a molecular weight of 488.75 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(3,3-difluorocyclopentyl)-2,6-naphthyridin-1-amine.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(3,3-difluorocyclopentyl)-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 139385498 |
| Molecular Formula | C21H18Cl3F2N3O2 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(3,3-difluorocyclopentyl)-2,6-naphthyridin-1-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3c(NC3CCC(F)(F)C3)n2)c1Cl |
| InChI | InChI=1S/C21H18Cl3F2N3O2/c1-30-14-7-15(31-2)19(24)17(18(14)23)13-5-10-9-27-16(22)6-12(10)20(29-13)28-11-3-4-21(25,26)8-11/h5-7,9,11H,3-4,8H2,1-2H3,(H,28,29) |
| InChIKey | SAONDHHYMBSMFY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|