C18H13Cl3F3N3O2 — CID 139385530
7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2,2,2-trifluoroethyl)-2,6-naphthyridin-1-amine (PubChem CID 139385530) has the molecular formula C18H13Cl3F3N3O2 and a molecular weight of 466.67 g/mol. Its IUPAC name is 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2,2,2-trifluoroethyl)-2,6-naphthyridin-1-amine.
| Compound Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2,2,2-trifluoroethyl)-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 139385530 |
| Molecular Formula | C18H13Cl3F3N3O2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 7-chloro-3-(2,6-dichloro-3,5-dimethoxyphenyl)-N-(2,2,2-trifluoroethyl)-2,6-naphthyridin-1-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Cl)cc3c(NCC(F)(F)F)n2)c1Cl |
| InChI | InChI=1S/C18H13Cl3F3N3O2/c1-28-11-5-12(29-2)16(21)14(15(11)20)10-3-8-6-25-13(19)4-9(8)17(27-10)26-7-18(22,23)24/h3-6H,7H2,1-2H3,(H,26,27) |
| InChIKey | PJZFFTHYTIOSKU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|