About 6-heptan-2-yl-2-methyl-6H-1,3-thiazine
6-heptan-2-yl-2-methyl-6H-1,3-thiazine (PubChem CID 139385882) has the molecular formula C12H21NS
and a molecular weight of 211.37 g/mol. Its IUPAC name is 6-heptan-2-yl-2-methyl-6H-1,3-thiazine.
Molecular Properties
| Compound Name | 6-heptan-2-yl-2-methyl-6H-1,3-thiazine |
| PubChem CID | 139385882 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 6-heptan-2-yl-2-methyl-6H-1,3-thiazine |
| SMILES | CCCCCC(C)C1C=CN=C(C)S1 |
| InChI | InChI=1S/C12H21NS/c1-4-5-6-7-10(2)12-8-9-13-11(3)14-12/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | WRJRWOQDAGOPGL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-heptan-2-yl-2-methyl-6H-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-heptan-2-yl-2-methyl-6H-1,3-thiazine?
The IUPAC name of 6-heptan-2-yl-2-methyl-6H-1,3-thiazine (CID 139385882) is 6-heptan-2-yl-2-methyl-6H-1,3-thiazine.
What is the SMILES notation for 6-heptan-2-yl-2-methyl-6H-1,3-thiazine?
The canonical SMILES for 6-heptan-2-yl-2-methyl-6H-1,3-thiazine is CCCCCC(C)C1C=CN=C(C)S1.
What is the InChIKey of 6-heptan-2-yl-2-methyl-6H-1,3-thiazine?
The InChIKey is WRJRWOQDAGOPGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NS/c1-4-5-6-7-10(2)12-8-9-13-11(3)14-12/h8-10,12H,4-7H2,1-3H3.
What are the key properties of 6-heptan-2-yl-2-methyl-6H-1,3-thiazine?
6-heptan-2-yl-2-methyl-6H-1,3-thiazine has a molecular weight of 211.37 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-heptan-2-yl-2-methyl-6H-1,3-thiazine is sourced from PubChem (CID 139385882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).