About N,3-dimethyl-1,2,4-triazol-4-amine
N,3-dimethyl-1,2,4-triazol-4-amine (PubChem CID 139385925) has the molecular formula C4H8N4
and a molecular weight of 112.14 g/mol. Its IUPAC name is N,3-dimethyl-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | N,3-dimethyl-1,2,4-triazol-4-amine |
| PubChem CID | 139385925 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | N,3-dimethyl-1,2,4-triazol-4-amine |
| SMILES | CNn1cnnc1C |
| InChI | InChI=1S/C4H8N4/c1-4-7-6-3-8(4)5-2/h3,5H,1-2H3 |
| InChIKey | ANQLACYHWCRSOF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,3-dimethyl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-1,2,4-triazol-4-amine?
The IUPAC name of N,3-dimethyl-1,2,4-triazol-4-amine (CID 139385925) is N,3-dimethyl-1,2,4-triazol-4-amine.
What is the SMILES notation for N,3-dimethyl-1,2,4-triazol-4-amine?
The canonical SMILES for N,3-dimethyl-1,2,4-triazol-4-amine is CNn1cnnc1C.
What is the InChIKey of N,3-dimethyl-1,2,4-triazol-4-amine?
The InChIKey is ANQLACYHWCRSOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4/c1-4-7-6-3-8(4)5-2/h3,5H,1-2H3.
What are the key properties of N,3-dimethyl-1,2,4-triazol-4-amine?
N,3-dimethyl-1,2,4-triazol-4-amine has a molecular weight of 112.14 g/mol, XLogP of -0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-1,2,4-triazol-4-amine is sourced from PubChem (CID 139385925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).