About (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione
(2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione (PubChem CID 139386028) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione.
Molecular Properties
| Compound Name | (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione |
| PubChem CID | 139386028 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione |
| SMILES | C/C=C/C=C1/C(=O)c2ccccc2C(=O)/C1=C/C |
| InChI | InChI=1S/C16H14O2/c1-3-5-8-12-11(4-2)15(17)13-9-6-7-10-14(13)16(12)18/h3-10H,1-2H3/b5-3+,11-4+,12-8+ |
| InChIKey | OTZJBLNNCOHUSC-VLFCKUMNSA-N |
| XLogP | 3.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione?
The IUPAC name of (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione (CID 139386028) is (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione.
What is the SMILES notation for (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione?
The canonical SMILES for (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione is C/C=C/C=C1/C(=O)c2ccccc2C(=O)/C1=C/C.
What is the InChIKey of (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione?
The InChIKey is OTZJBLNNCOHUSC-VLFCKUMNSA-N. The full InChI is InChI=1S/C16H14O2/c1-3-5-8-12-11(4-2)15(17)13-9-6-7-10-14(13)16(12)18/h3-10H,1-2H3/b5-3+,11-4+,12-8+.
What are the key properties of (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione?
(2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione has a molecular weight of 238.29 g/mol, XLogP of 3.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-2-[(E)-but-2-enylidene]-3-ethylidenenaphthalene-1,4-dione is sourced from PubChem (CID 139386028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).