C21H18F2N8O3S — CID 139386303
N,N'-diamino-4-[3-[2,4-difluoro-3-(methanesulfonamido)benzoyl]-2H-pyrazolo[3,4-b]pyridin-5-yl]benzenecarboximidamide (PubChem CID 139386303) has the molecular formula C21H18F2N8O3S and a molecular weight of 500.49 g/mol. Its IUPAC name is N,N'-diamino-4-[3-[2,4-difluoro-3-(methanesulfonamido)benzoyl]-2H-pyrazolo[3,4-b]pyridin-5-yl]benzenecarboximidamide.
| Compound Name | N,N'-diamino-4-[3-[2,4-difluoro-3-(methanesulfonamido)benzoyl]-2H-pyrazolo[3,4-b]pyridin-5-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 139386303 |
| Molecular Formula | C21H18F2N8O3S |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | N,N'-diamino-4-[3-[2,4-difluoro-3-(methanesulfonamido)benzoyl]-2H-pyrazolo[3,4-b]pyridin-5-yl]benzenecarboximidamide |
| SMILES | CS(=O)(=O)Nc1c(F)ccc(C(=O)c2[nH]nc3ncc(-c4ccc(/C(=N/N)NN)cc4)cc23)c1F |
| InChI | InChI=1S/C21H18F2N8O3S/c1-35(33,34)31-18-15(22)7-6-13(16(18)23)19(32)17-14-8-12(9-26-21(14)30-29-17)10-2-4-11(5-3-10)20(27-24)28-25/h2-9,31H,24-25H2,1H3,(H,27,28)(H,26,29,30) |
| InChIKey | CYKZZRAEZXMSAC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 181.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|