C13H15F3N2O — CID 139386392
(1E,3E)-1-amino-4-(aminomethyl)-1-cyclohepta-1,3,5-trien-1-yl-5,5,5-trifluoropenta-1,3-dien-2-ol (PubChem CID 139386392) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is (1E,3E)-1-amino-4-(aminomethyl)-1-cyclohepta-1,3,5-trien-1-yl-5,5,5-trifluoropenta-1,3-dien-2-ol.
| Compound Name | (1E,3E)-1-amino-4-(aminomethyl)-1-cyclohepta-1,3,5-trien-1-yl-5,5,5-trifluoropenta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 139386392 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (1E,3E)-1-amino-4-(aminomethyl)-1-cyclohepta-1,3,5-trien-1-yl-5,5,5-trifluoropenta-1,3-dien-2-ol |
| SMILES | NC/C(=C\C(O)=C(/N)C1=CC=CC=CC1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O/c14-13(15,16)10(8-17)7-11(19)12(18)9-5-3-1-2-4-6-9/h1-5,7,19H,6,8,17-18H2/b10-7+,12-11+ |
| InChIKey | YTJVRKOKRUBMQM-OFJXCKHESA-N |
| XLogP | 2.60 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|