C18H20F3NO — CID 139386398
(2E,4Z)-N-methyl-1-phenyl-2-prop-2-enoxy-4-(trifluoromethyl)hepta-2,4-dien-1-imine (PubChem CID 139386398) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is (2E,4Z)-N-methyl-1-phenyl-2-prop-2-enoxy-4-(trifluoromethyl)hepta-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-N-methyl-1-phenyl-2-prop-2-enoxy-4-(trifluoromethyl)hepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 139386398 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2E,4Z)-N-methyl-1-phenyl-2-prop-2-enoxy-4-(trifluoromethyl)hepta-2,4-dien-1-imine |
| SMILES | C=CCOC(=C/C(=C/CC)C(F)(F)F)/C(=N/C)c1ccccc1 |
| InChI | InChI=1S/C18H20F3NO/c1-4-9-15(18(19,20)21)13-16(23-12-5-2)17(22-3)14-10-7-6-8-11-14/h5-11,13H,2,4,12H2,1,3H3/b15-9-,16-13+,22-17+ |
| InChIKey | YLLOEOKUFMYNTJ-SURYZWFSSA-N |
| XLogP | 5.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|