C38H30F4N2O2S3 — CID 139386612
4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]benzo[f][2,1,3]benzothiadiazole (PubChem CID 139386612) has the molecular formula C38H30F4N2O2S3 and a molecular weight of 718.86 g/mol. Its IUPAC name is 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]benzo[f][2,1,3]benzothiadiazole.
| Compound Name | 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]benzo[f][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 139386612 |
| Molecular Formula | C38H30F4N2O2S3 |
| Molecular Weight | 718.86 g/mol |
| Exact Mass | 718.14 |
| IUPAC Name | 4,9-bis[5-[4-(1,1-difluorobutoxy)phenyl]thiophen-2-yl]benzo[f][2,1,3]benzothiadiazole |
| SMILES | CCCC(F)(F)Oc1ccc(-c2ccc(-c3c4ccccc4c(-c4ccc(-c5ccc(OC(F)(F)CCC)cc5)s4)c4nsnc34)s2)cc1 |
| InChI | InChI=1S/C38H30F4N2O2S3/c1-3-21-37(39,40)45-25-13-9-23(10-14-25)29-17-19-31(47-29)33-27-7-5-6-8-28(27)34(36-35(33)43-49-44-36)32-20-18-30(48-32)24-11-15-26(16-12-24)46-38(41,42)22-4-2/h5-20H,3-4,21-22H2,1-2H3 |
| InChIKey | MPNXMSVEKAHKQC-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.86 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |