About N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride
N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride (PubChem CID 139386680) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride.
Molecular Properties
| Compound Name | N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride |
| PubChem CID | 139386680 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride |
| SMILES | C/C=C\[C@](C)(CC)C/N=C/F |
| InChI | InChI=1S/C9H16FN/c1-4-6-9(3,5-2)7-11-8-10/h4,6,8H,5,7H2,1-3H3/b6-4-,11-8+/t9-/m0/s1 |
| InChIKey | KLVMWQSOCCTJNQ-ZFURPVGASA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride?
The IUPAC name of N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride (CID 139386680) is N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride.
What is the SMILES notation for N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride?
The canonical SMILES for N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride is C/C=C\[C@](C)(CC)C/N=C/F.
What is the InChIKey of N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride?
The InChIKey is KLVMWQSOCCTJNQ-ZFURPVGASA-N. The full InChI is InChI=1S/C9H16FN/c1-4-6-9(3,5-2)7-11-8-10/h4,6,8H,5,7H2,1-3H3/b6-4-,11-8+/t9-/m0/s1.
What are the key properties of N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride?
N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride has a molecular weight of 157.23 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z,2S)-2-ethyl-2-methylpent-3-enyl]methanimidoyl fluoride is sourced from PubChem (CID 139386680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).