C29H29F8NO3S — CID 139386988
1-[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,3a,4,5-tetrahydro-1H-benzo[e]isoindol-2-yl]-2-cyclohexylethanone (PubChem CID 139386988) has the molecular formula C29H29F8NO3S and a molecular weight of 623.61 g/mol. Its IUPAC name is 1-[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,3a,4,5-tetrahydro-1H-benzo[e]isoindol-2-yl]-2-cyclohexylethanone.
| Compound Name | 1-[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,3a,4,5-tetrahydro-1H-benzo[e]isoindol-2-yl]-2-cyclohexylethanone |
|---|---|
| PubChem CID | 139386988 |
| Molecular Formula | C29H29F8NO3S |
| Molecular Weight | 623.61 g/mol |
| Exact Mass | 623.17 |
| IUPAC Name | 1-[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3,3a,4,5-tetrahydro-1H-benzo[e]isoindol-2-yl]-2-cyclohexylethanone |
| SMILES | O=C(CC1CCCCC1)N1CC2CCc3cc(C(F)(C(F)(F)F)C(F)(F)F)ccc3C2(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C29H29F8NO3S/c30-22-9-11-23(12-10-22)42(40,41)26-17-38(25(39)14-18-4-2-1-3-5-18)16-21(26)7-6-19-15-20(8-13-24(19)26)27(31,28(32,33)34)29(35,36)37/h8-13,15,18,21H,1-7,14,16-17H2 |
| InChIKey | ASHIZLLJJCLBPO-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.61 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |