C26H18N8O2S2 — CID 139387306
8-amino-5-[[5-[2-[(4-amino-5-hydroxynaphthalen-1-yl)diazenyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]diazenyl]naphthalen-1-ol (PubChem CID 139387306) has the molecular formula C26H18N8O2S2 and a molecular weight of 538.62 g/mol. Its IUPAC name is 8-amino-5-[[5-[2-[(4-amino-5-hydroxynaphthalen-1-yl)diazenyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]diazenyl]naphthalen-1-ol.
| Compound Name | 8-amino-5-[[5-[2-[(4-amino-5-hydroxynaphthalen-1-yl)diazenyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]diazenyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 139387306 |
| Molecular Formula | C26H18N8O2S2 |
| Molecular Weight | 538.62 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 8-amino-5-[[5-[2-[(4-amino-5-hydroxynaphthalen-1-yl)diazenyl]-1,3-thiazol-5-yl]-1,3-thiazol-2-yl]diazenyl]naphthalen-1-ol |
| SMILES | Nc1ccc(/N=N/c2ncc(-c3cnc(/N=N/c4ccc(N)c5c(O)cccc45)s3)s2)c2cccc(O)c12 |
| InChI | InChI=1S/C26H18N8O2S2/c27-15-7-9-17(13-3-1-5-19(35)23(13)15)31-33-25-29-11-21(37-25)22-12-30-26(38-22)34-32-18-10-8-16(28)24-14(18)4-2-6-20(24)36/h1-12,35-36H,27-28H2/b33-31+,34-32+ |
| InChIKey | WQNRXPJSXWTQJB-FMWAKIAMSA-N |
| XLogP | 7.98 |
| TPSA | 167.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.62 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|