C9H16N2 — CID 139387528
N'-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]ethanimidamide (PubChem CID 139387528) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 139387528 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-[(1E,3E)-2,3-dimethylpenta-1,3-dienyl]ethanimidamide |
| SMILES | C/C=C(C)/C(C)=C/N=C(\C)N |
| InChI | InChI=1S/C9H16N2/c1-5-7(2)8(3)6-11-9(4)10/h5-6H,1-4H3,(H2,10,11)/b7-5+,8-6+ |
| InChIKey | ZFPOLCJTNBJWIR-KQQUZDAGSA-N |
| XLogP | 2.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|