C10H14F3N3O2 — CID 139388882
(Z)-3-acetamido-2-[[methyl(3,3,3-trifluoroprop-1-en-2-yl)amino]methyl]prop-2-enamide (PubChem CID 139388882) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is (Z)-3-acetamido-2-[[methyl(3,3,3-trifluoroprop-1-en-2-yl)amino]methyl]prop-2-enamide.
| Compound Name | (Z)-3-acetamido-2-[[methyl(3,3,3-trifluoroprop-1-en-2-yl)amino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 139388882 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (Z)-3-acetamido-2-[[methyl(3,3,3-trifluoroprop-1-en-2-yl)amino]methyl]prop-2-enamide |
| SMILES | C=C(N(C)C/C(=C/NC(C)=O)C(N)=O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N3O2/c1-6(10(11,12)13)16(3)5-8(9(14)18)4-15-7(2)17/h4H,1,5H2,2-3H3,(H2,14,18)(H,15,17)/b8-4- |
| InChIKey | SWOWGCAEDZFBQD-YWEYNIOJSA-N |
| XLogP | 0.50 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|