C30H35ClF3N5O5S — CID 139388926
2-chloro-N-[4-[3-(5,5-dimethylpyrrolidin-3-yl)propoxy]phenyl]sulfonyl-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide (PubChem CID 139388926) has the molecular formula C30H35ClF3N5O5S and a molecular weight of 670.15 g/mol. Its IUPAC name is 2-chloro-N-[4-[3-(5,5-dimethylpyrrolidin-3-yl)propoxy]phenyl]sulfonyl-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-[3-(5,5-dimethylpyrrolidin-3-yl)propoxy]phenyl]sulfonyl-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139388926 |
| Molecular Formula | C30H35ClF3N5O5S |
| Molecular Weight | 670.15 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | 2-chloro-N-[4-[3-(5,5-dimethylpyrrolidin-3-yl)propoxy]phenyl]sulfonyl-6-[3-[2-[1-(trifluoromethyl)cyclopropyl]ethoxy]pyrazol-1-yl]pyridine-3-carboxamide |
| SMILES | CC1(C)CC(CCCOc2ccc(S(=O)(=O)NC(=O)c3ccc(-n4ccc(OCCC5(C(F)(F)F)CC5)n4)nc3Cl)cc2)CN1 |
| InChI | InChI=1S/C30H35ClF3N5O5S/c1-28(2)18-20(19-35-28)4-3-16-43-21-5-7-22(8-6-21)45(41,42)38-27(40)23-9-10-24(36-26(23)31)39-15-11-25(37-39)44-17-14-29(12-13-29)30(32,33)34/h5-11,15,20,35H,3-4,12-14,16-19H2,1-2H3,(H,38,40) |
| InChIKey | CTRIAFXEWNUGJC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.15 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|