About 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid
6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid (PubChem CID 139389286) has the molecular formula C17H25ClN2O5
and a molecular weight of 372.85 g/mol. Its IUPAC name is 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid |
| PubChem CID | 139389286 |
| Molecular Formula | C17H25ClN2O5 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid |
| SMILES | CC(C)(C)CCCOC(CCNc1ccc(C(=O)O)c(Cl)n1)C(=O)O |
| InChI | InChI=1S/C17H25ClN2O5/c1-17(2,3)8-4-10-25-12(16(23)24)7-9-19-13-6-5-11(15(21)22)14(18)20-13/h5-6,12H,4,7-10H2,1-3H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | VUGUODNMVHHDQC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid?
The IUPAC name of 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid (CID 139389286) is 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid.
What is the SMILES notation for 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid?
The canonical SMILES for 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid is CC(C)(C)CCCOC(CCNc1ccc(C(=O)O)c(Cl)n1)C(=O)O.
What is the InChIKey of 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid?
The InChIKey is VUGUODNMVHHDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25ClN2O5/c1-17(2,3)8-4-10-25-12(16(23)24)7-9-19-13-6-5-11(15(21)22)14(18)20-13/h5-6,12H,4,7-10H2,1-3H3,(H,19,20)(H,21,22)(H,23,24).
What are the key properties of 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid?
6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid has a molecular weight of 372.85 g/mol, XLogP of 3.53, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3-carboxy-3-(4,4-dimethylpentoxy)propyl]amino]-2-chloropyridine-3-carboxylic acid is sourced from PubChem (CID 139389286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).