About 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine
6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine (PubChem CID 139390080) has the molecular formula C11H13BrFNO
and a molecular weight of 274.13 g/mol. Its IUPAC name is 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 139390080 |
| Molecular Formula | C11H13BrFNO |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CC(C)N1CCOc2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C11H13BrFNO/c1-7(2)14-3-4-15-11-9(13)5-8(12)6-10(11)14/h5-7H,3-4H2,1-2H3 |
| InChIKey | HZBXHZHGDSZTDK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine (CID 139390080) is 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine is CC(C)N1CCOc2c(F)cc(Br)cc21.
What is the InChIKey of 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is HZBXHZHGDSZTDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrFNO/c1-7(2)14-3-4-15-11-9(13)5-8(12)6-10(11)14/h5-7H,3-4H2,1-2H3.
What are the key properties of 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine?
6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 274.13 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 139390080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).