C23H24F2N6O — CID 139390209
N-[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine (PubChem CID 139390209) has the molecular formula C23H24F2N6O and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine.
| Compound Name | N-[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 139390209 |
| Molecular Formula | C23H24F2N6O |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-[5-fluoro-4-(8-fluoro-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-5,6,7,8-tetrahydro-1,6-naphthyridin-2-amine |
| SMILES | CC(C)N1CCOc2c(F)cc(-c3nc(Nc4ccc5c(n4)CCNC5)ncc3F)cc21 |
| InChI | InChI=1S/C23H24F2N6O/c1-13(2)31-7-8-32-22-16(24)9-15(10-19(22)31)21-17(25)12-27-23(30-21)29-20-4-3-14-11-26-6-5-18(14)28-20/h3-4,9-10,12-13,26H,5-8,11H2,1-2H3,(H,27,28,29,30) |
| InChIKey | PSWOMNFIVDHMDM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |