About 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine
1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine (PubChem CID 139390411) has the molecular formula C7H10N4
and a molecular weight of 150.18 g/mol. Its IUPAC name is 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine |
| PubChem CID | 139390411 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine |
| SMILES | C=C(N)Nc1nccc(C)n1 |
| InChI | InChI=1S/C7H10N4/c1-5-3-4-9-7(10-5)11-6(2)8/h3-4H,2,8H2,1H3,(H,9,10,11) |
| InChIKey | VBNFSQSSIXODPP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine?
The IUPAC name of 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine (CID 139390411) is 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine.
What is the SMILES notation for 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine?
The canonical SMILES for 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine is C=C(N)Nc1nccc(C)n1.
What is the InChIKey of 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine?
The InChIKey is VBNFSQSSIXODPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4/c1-5-3-4-9-7(10-5)11-6(2)8/h3-4H,2,8H2,1H3,(H,9,10,11).
What are the key properties of 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine?
1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine has a molecular weight of 150.18 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-(4-methylpyrimidin-2-yl)ethene-1,1-diamine is sourced from PubChem (CID 139390411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).