C9H12Cl6N6 — CID 139391218
1,2,3,4,5,6-hexachlorocyclohexane;1,3,5-triazine-2,4,6-triamine (PubChem CID 139391218) has the molecular formula C9H12Cl6N6 and a molecular weight of 416.96 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachlorocyclohexane;1,3,5-triazine-2,4,6-triamine.
| Compound Name | 1,2,3,4,5,6-hexachlorocyclohexane;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 139391218 |
| Molecular Formula | C9H12Cl6N6 |
| Molecular Weight | 416.96 g/mol |
| Exact Mass | 413.93 |
| IUPAC Name | 1,2,3,4,5,6-hexachlorocyclohexane;1,3,5-triazine-2,4,6-triamine |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.Nc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C6H6Cl6.C3H6N6/c7-1-2(8)4(10)6(12)5(11)3(1)9;4-1-7-2(5)9-3(6)8-1/h1-6H;(H6,4,5,6,7,8,9) |
| InChIKey | UTEJKCDUSAJJSJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.96 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|