C25H26N2O4S — CID 139391521
2-[[4-(2-methoxyethylamino)benzoyl]amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid (PubChem CID 139391521) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-[[4-(2-methoxyethylamino)benzoyl]amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid.
| Compound Name | 2-[[4-(2-methoxyethylamino)benzoyl]amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 139391521 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[[4-(2-methoxyethylamino)benzoyl]amino]-4-(1,2,3,4-tetrahydronaphthalen-2-yl)thiophene-3-carboxylic acid |
| SMILES | COCCNc1ccc(C(=O)Nc2scc(C3CCc4ccccc4C3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C25H26N2O4S/c1-31-13-12-26-20-10-8-17(9-11-20)23(28)27-24-22(25(29)30)21(15-32-24)19-7-6-16-4-2-3-5-18(16)14-19/h2-5,8-11,15,19,26H,6-7,12-14H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | ZGYMJDKHZOKSEZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|