About 4-ethyl-3-methyloxet-2-one;2-ethyloxetane
4-ethyl-3-methyloxet-2-one;2-ethyloxetane (PubChem CID 139391822) has the molecular formula C11H18O3
and a molecular weight of 198.26 g/mol. Its IUPAC name is 4-ethyl-3-methyloxet-2-one;2-ethyloxetane.
Molecular Properties
| Compound Name | 4-ethyl-3-methyloxet-2-one;2-ethyloxetane |
| PubChem CID | 139391822 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 4-ethyl-3-methyloxet-2-one;2-ethyloxetane |
| SMILES | CCC1=C(C)C(=O)O1.CCC1CCO1 |
| InChI | InChI=1S/C6H8O2.C5H10O/c1-3-5-4(2)6(7)8-5;1-2-5-3-4-6-5/h3H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | ARBRGNLYUJDJIL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-3-methyloxet-2-one;2-ethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3-methyloxet-2-one;2-ethyloxetane?
The IUPAC name of 4-ethyl-3-methyloxet-2-one;2-ethyloxetane (CID 139391822) is 4-ethyl-3-methyloxet-2-one;2-ethyloxetane.
What is the SMILES notation for 4-ethyl-3-methyloxet-2-one;2-ethyloxetane?
The canonical SMILES for 4-ethyl-3-methyloxet-2-one;2-ethyloxetane is CCC1=C(C)C(=O)O1.CCC1CCO1.
What is the InChIKey of 4-ethyl-3-methyloxet-2-one;2-ethyloxetane?
The InChIKey is ARBRGNLYUJDJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2.C5H10O/c1-3-5-4(2)6(7)8-5;1-2-5-3-4-6-5/h3H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of 4-ethyl-3-methyloxet-2-one;2-ethyloxetane?
4-ethyl-3-methyloxet-2-one;2-ethyloxetane has a molecular weight of 198.26 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3-methyloxet-2-one;2-ethyloxetane is sourced from PubChem (CID 139391822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).