About 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol
4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol (PubChem CID 139391966) has the molecular formula C21H21N5O
and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol.
Molecular Properties
| Compound Name | 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol |
| PubChem CID | 139391966 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol |
| SMILES | Cc1cc(O)ccc1Nc1cc(-c2ccc(-c3c(C)n[nH]c3C)cc2)[nH]n1 |
| InChI | InChI=1S/C21H21N5O/c1-12-10-17(27)8-9-18(12)22-20-11-19(25-26-20)15-4-6-16(7-5-15)21-13(2)23-24-14(21)3/h4-11,27H,1-3H3,(H,23,24)(H2,22,25,26) |
| InChIKey | KYFYQNXANZLSIA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol?
The IUPAC name of 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol (CID 139391966) is 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol.
What is the SMILES notation for 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol?
The canonical SMILES for 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol is Cc1cc(O)ccc1Nc1cc(-c2ccc(-c3c(C)n[nH]c3C)cc2)[nH]n1.
What is the InChIKey of 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol?
The InChIKey is KYFYQNXANZLSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O/c1-12-10-17(27)8-9-18(12)22-20-11-19(25-26-20)15-4-6-16(7-5-15)21-13(2)23-24-14(21)3/h4-11,27H,1-3H3,(H,23,24)(H2,22,25,26).
What are the key properties of 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol?
4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol has a molecular weight of 359.43 g/mol, XLogP of 4.84, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-1H-pyrazol-3-yl]amino]-3-methylphenol is sourced from PubChem (CID 139391966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).