About [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid
[5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid (PubChem CID 139392909) has the molecular formula C20H24ClN3O4
and a molecular weight of 405.88 g/mol. Its IUPAC name is [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid.
Molecular Properties
| Compound Name | [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid |
| PubChem CID | 139392909 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid |
| SMILES | COc1ccc(CN(C(=O)O)c2cc(N3CCOC(C)C3C)ncc2Cl)cc1 |
| InChI | InChI=1S/C20H24ClN3O4/c1-13-14(2)28-9-8-23(13)19-10-18(17(21)11-22-19)24(20(25)26)12-15-4-6-16(27-3)7-5-15/h4-7,10-11,13-14H,8-9,12H2,1-3H3,(H,25,26) |
| InChIKey | KWWISDKVGBVQHH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid?
The IUPAC name of [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid (CID 139392909) is [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid.
What is the SMILES notation for [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid?
The canonical SMILES for [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid is COc1ccc(CN(C(=O)O)c2cc(N3CCOC(C)C3C)ncc2Cl)cc1.
What is the InChIKey of [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid?
The InChIKey is KWWISDKVGBVQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24ClN3O4/c1-13-14(2)28-9-8-23(13)19-10-18(17(21)11-22-19)24(20(25)26)12-15-4-6-16(27-3)7-5-15/h4-7,10-11,13-14H,8-9,12H2,1-3H3,(H,25,26).
What are the key properties of [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid?
[5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid has a molecular weight of 405.88 g/mol, XLogP of 4.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-2-(2,3-dimethylmorpholin-4-yl)-4-pyridinyl]-[(4-methoxyphenyl)methyl]carbamic acid is sourced from PubChem (CID 139392909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).