About 2-aminoimidazo[1,5-a]pyrazin-3-one
2-aminoimidazo[1,5-a]pyrazin-3-one (PubChem CID 139392957) has the molecular formula C6H6N4O
and a molecular weight of 150.14 g/mol. Its IUPAC name is 2-aminoimidazo[1,5-a]pyrazin-3-one.
Molecular Properties
| Compound Name | 2-aminoimidazo[1,5-a]pyrazin-3-one |
| PubChem CID | 139392957 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2-aminoimidazo[1,5-a]pyrazin-3-one |
| SMILES | Nn1cc2cnccn2c1=O |
| InChI | InChI=1S/C6H6N4O/c7-10-4-5-3-8-1-2-9(5)6(10)11/h1-4H,7H2 |
| InChIKey | ZHSWPWCHAATPEJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminoimidazo[1,5-a]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoimidazo[1,5-a]pyrazin-3-one?
The IUPAC name of 2-aminoimidazo[1,5-a]pyrazin-3-one (CID 139392957) is 2-aminoimidazo[1,5-a]pyrazin-3-one.
What is the SMILES notation for 2-aminoimidazo[1,5-a]pyrazin-3-one?
The canonical SMILES for 2-aminoimidazo[1,5-a]pyrazin-3-one is Nn1cc2cnccn2c1=O.
What is the InChIKey of 2-aminoimidazo[1,5-a]pyrazin-3-one?
The InChIKey is ZHSWPWCHAATPEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4O/c7-10-4-5-3-8-1-2-9(5)6(10)11/h1-4H,7H2.
What are the key properties of 2-aminoimidazo[1,5-a]pyrazin-3-one?
2-aminoimidazo[1,5-a]pyrazin-3-one has a molecular weight of 150.14 g/mol, XLogP of -0.79, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoimidazo[1,5-a]pyrazin-3-one is sourced from PubChem (CID 139392957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).