C12H12F6O6S — CID 139393199
1,1,1,3,3,3-hexafluoro-2-(4-oxatricyclo[4.2.1.03,7]nonan-2-yloxycarbonyl)propane-2-sulfonic acid (PubChem CID 139393199) has the molecular formula C12H12F6O6S and a molecular weight of 398.28 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(4-oxatricyclo[4.2.1.03,7]nonan-2-yloxycarbonyl)propane-2-sulfonic acid.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(4-oxatricyclo[4.2.1.03,7]nonan-2-yloxycarbonyl)propane-2-sulfonic acid |
|---|---|
| PubChem CID | 139393199 |
| Molecular Formula | C12H12F6O6S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(4-oxatricyclo[4.2.1.03,7]nonan-2-yloxycarbonyl)propane-2-sulfonic acid |
| SMILES | O=C(OC1C2CC3COC1C3C2)C(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C12H12F6O6S/c13-11(14,15)10(12(16,17)18,25(20,21)22)9(19)24-7-4-1-5-3-23-8(7)6(5)2-4/h4-8H,1-3H2,(H,20,21,22) |
| InChIKey | LABVULXDAODWSB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|