C24H24FN3O6 — CID 139393478
methyl (4R)-4-[[5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-2-oxopentanoate (PubChem CID 139393478) has the molecular formula C24H24FN3O6 and a molecular weight of 469.47 g/mol. Its IUPAC name is methyl (4R)-4-[[5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-2-oxopentanoate.
| Compound Name | methyl (4R)-4-[[5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-2-oxopentanoate |
|---|---|
| PubChem CID | 139393478 |
| Molecular Formula | C24H24FN3O6 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | methyl (4R)-4-[[5-(2,6-dimethoxyphenyl)-1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]-2-oxopentanoate |
| SMILES | COC(=O)C(=O)C[C@@H](C)NC(=O)c1cc(-c2c(OC)cccc2OC)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C24H24FN3O6/c1-14(12-19(29)24(31)34-4)26-23(30)17-13-18(22-20(32-2)6-5-7-21(22)33-3)28(27-17)16-10-8-15(25)9-11-16/h5-11,13-14H,12H2,1-4H3,(H,26,30)/t14-/m1/s1 |
| InChIKey | JTVBQNQRIYPNLZ-CQSZACIVSA-N |
| XLogP | 2.95 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|