About 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one
2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 139393553) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| PubChem CID | 139393553 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | CCC1C=Nc2c1nc(N)[nH]c2=O |
| InChI | InChI=1S/C8H10N4O/c1-2-4-3-10-6-5(4)11-8(9)12-7(6)13/h3-4H,2H2,1H3,(H3,9,11,12,13) |
| InChIKey | MVGIDQHSYAWARQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one (CID 139393553) is 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one is CCC1C=Nc2c1nc(N)[nH]c2=O.
What is the InChIKey of 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one?
The InChIKey is MVGIDQHSYAWARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-2-4-3-10-6-5(4)11-8(9)12-7(6)13/h3-4H,2H2,1H3,(H3,9,11,12,13).
What are the key properties of 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one?
2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one has a molecular weight of 178.19 g/mol, XLogP of 0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-ethyl-3,7-dihydropyrrolo[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 139393553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).