About 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene
1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene (PubChem CID 139393975) has the molecular formula C15H18I2
and a molecular weight of 452.12 g/mol. Its IUPAC name is 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene.
Molecular Properties
| Compound Name | 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene |
| PubChem CID | 139393975 |
| Molecular Formula | C15H18I2 |
| Molecular Weight | 452.12 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene |
| SMILES | CCc1c(C)c(C2CC2)c(I)c(I)c1C1CC1 |
| InChI | InChI=1S/C15H18I2/c1-3-11-8(2)12(9-4-5-9)14(16)15(17)13(11)10-6-7-10/h9-10H,3-7H2,1-2H3 |
| InChIKey | RLYKWGPPDDBEOX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.12 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene?
The IUPAC name of 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene (CID 139393975) is 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene.
What is the SMILES notation for 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene?
The canonical SMILES for 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene is CCc1c(C)c(C2CC2)c(I)c(I)c1C1CC1.
What is the InChIKey of 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene?
The InChIKey is RLYKWGPPDDBEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18I2/c1-3-11-8(2)12(9-4-5-9)14(16)15(17)13(11)10-6-7-10/h9-10H,3-7H2,1-2H3.
What are the key properties of 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene?
1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene has a molecular weight of 452.12 g/mol, XLogP of 5.52, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dicyclopropyl-2-ethyl-5,6-diiodo-3-methylbenzene is sourced from PubChem (CID 139393975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).