About (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione
(4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione (PubChem CID 139394302) has the molecular formula C19H15ClF2O3
and a molecular weight of 364.78 g/mol. Its IUPAC name is (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione.
Molecular Properties
| Compound Name | (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione |
| PubChem CID | 139394302 |
| Molecular Formula | C19H15ClF2O3 |
| Molecular Weight | 364.78 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione |
| SMILES | COc1cc(-c2ccc(F)cc2F)cc(Cl)c1C1C(=O)C[C@@H](C)C1=O |
| InChI | InChI=1S/C19H15ClF2O3/c1-9-5-15(23)18(19(9)24)17-13(20)6-10(7-16(17)25-2)12-4-3-11(21)8-14(12)22/h3-4,6-9,18H,5H2,1-2H3/t9-,18?/m1/s1 |
| InChIKey | MBBNXXQGLUJGRU-XSOCLTCRSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione?
The IUPAC name of (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione (CID 139394302) is (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione.
What is the SMILES notation for (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione?
The canonical SMILES for (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione is COc1cc(-c2ccc(F)cc2F)cc(Cl)c1C1C(=O)C[C@@H](C)C1=O.
What is the InChIKey of (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione?
The InChIKey is MBBNXXQGLUJGRU-XSOCLTCRSA-N. The full InChI is InChI=1S/C19H15ClF2O3/c1-9-5-15(23)18(19(9)24)17-13(20)6-10(7-16(17)25-2)12-4-3-11(21)8-14(12)22/h3-4,6-9,18H,5H2,1-2H3/t9-,18?/m1/s1.
What are the key properties of (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione?
(4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione has a molecular weight of 364.78 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-methylcyclopentane-1,3-dione is sourced from PubChem (CID 139394302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).