C20H24N4O5S — CID 139394651
[(2S,4R)-2-[[[(Z)-ethylideneamino]-(methylideneamino)amino]methyl]-2-pyridin-2-yl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 139394651) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is [(2S,4R)-2-[[[(Z)-ethylideneamino]-(methylideneamino)amino]methyl]-2-pyridin-2-yl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R)-2-[[[(Z)-ethylideneamino]-(methylideneamino)amino]methyl]-2-pyridin-2-yl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139394651 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [(2S,4R)-2-[[[(Z)-ethylideneamino]-(methylideneamino)amino]methyl]-2-pyridin-2-yl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C=NN(C[C@]1(c2ccccn2)OC[C@H](COS(=O)(=O)c2ccc(C)cc2)O1)/N=C\C |
| InChI | InChI=1S/C20H24N4O5S/c1-4-23-24(21-3)15-20(19-7-5-6-12-22-19)27-13-17(29-20)14-28-30(25,26)18-10-8-16(2)9-11-18/h4-12,17H,3,13-15H2,1-2H3/b23-4-/t17-,20+/m1/s1 |
| InChIKey | PCYBTZHLKYFCHM-YADVOWGJSA-N |
| XLogP | 2.29 |
| TPSA | 102.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|