C41H44ClN2+ — CID 139394919
2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-[(1E,5E,7Z)-2,2,4,5-tetramethyl-4-benzazonin-3-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium (PubChem CID 139394919) has the molecular formula C41H44ClN2+ and a molecular weight of 600.27 g/mol. Its IUPAC name is 2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-[(1E,5E,7Z)-2,2,4,5-tetramethyl-4-benzazonin-3-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium.
| Compound Name | 2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-[(1E,5E,7Z)-2,2,4,5-tetramethyl-4-benzazonin-3-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 139394919 |
| Molecular Formula | C41H44ClN2+ |
| Molecular Weight | 600.27 g/mol |
| Exact Mass | 599.32 |
| IUPAC Name | 2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-[(1E,5E,7Z)-2,2,4,5-tetramethyl-4-benzazonin-3-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-1,1,3-trimethylbenzo[e]indol-3-ium |
| SMILES | C/C1=C\C=c2\cccc\c2=C/C(C)(C)/C(=C\C=C2/CCCC(/C=C/C3=[N+](C)c4ccc5ccccc5c4C3(C)C)=C2Cl)N1C |
| InChI | InChI=1S/C41H44ClN2/c1-28-19-20-29-13-8-9-15-33(29)27-40(2,3)36(43(28)6)25-22-31-16-12-17-32(39(31)42)23-26-37-41(4,5)38-34-18-11-10-14-30(34)21-24-35(38)44(37)7/h8-11,13-15,18-27H,12,16-17H2,1-7H3/q+1/b28-19+,29-20-,33-27+ |
| InChIKey | LDFSQUHUBWZYCU-NAEIBZDRSA-N |
| XLogP | 9.03 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.27 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|