About (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine
(1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine (PubChem CID 139395249) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine.
Molecular Properties
| Compound Name | (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine |
| PubChem CID | 139395249 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine |
| SMILES | C=N/C=C\C=C(/C)C(N)CCCCCCCC |
| InChI | InChI=1S/C15H28N2/c1-4-5-6-7-8-9-12-15(16)14(2)11-10-13-17-3/h10-11,13,15H,3-9,12,16H2,1-2H3/b13-10-,14-11+ |
| InChIKey | GUUNOJRNWJHKGE-FXYWYECCSA-N |
| XLogP | 4.22 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine?
The IUPAC name of (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine (CID 139395249) is (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine.
What is the SMILES notation for (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine?
The canonical SMILES for (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine is C=N/C=C\C=C(/C)C(N)CCCCCCCC.
What is the InChIKey of (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine?
The InChIKey is GUUNOJRNWJHKGE-FXYWYECCSA-N. The full InChI is InChI=1S/C15H28N2/c1-4-5-6-7-8-9-12-15(16)14(2)11-10-13-17-3/h10-11,13,15H,3-9,12,16H2,1-2H3/b13-10-,14-11+.
What are the key properties of (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine?
(1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine has a molecular weight of 236.40 g/mol, XLogP of 4.22, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-4-methyl-1-(methylideneamino)trideca-1,3-dien-5-amine is sourced from PubChem (CID 139395249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).