C14H23N3 — CID 139395272
2-[(2Z,4E,8Z)-5-ethenylundeca-2,4,8-trien-6-yl]guanidine (PubChem CID 139395272) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-[(2Z,4E,8Z)-5-ethenylundeca-2,4,8-trien-6-yl]guanidine.
| Compound Name | 2-[(2Z,4E,8Z)-5-ethenylundeca-2,4,8-trien-6-yl]guanidine |
|---|---|
| PubChem CID | 139395272 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-[(2Z,4E,8Z)-5-ethenylundeca-2,4,8-trien-6-yl]guanidine |
| SMILES | C=C/C(=C\C=C/C)C(C/C=C\CC)N=C(N)N |
| InChI | InChI=1S/C14H23N3/c1-4-7-9-11-13(17-14(15)16)12(6-3)10-8-5-2/h5-10,13H,3-4,11H2,1-2H3,(H4,15,16,17)/b8-5-,9-7-,12-10+ |
| InChIKey | DXPADVZIJWMNMP-OOBUSIFRSA-N |
| XLogP | 2.67 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|