C21H20Cl2F2N4O2 — CID 139395608
3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-N-(3,3-difluorocyclopentyl)-2,6-naphthyridine-1,7-diamine (PubChem CID 139395608) has the molecular formula C21H20Cl2F2N4O2 and a molecular weight of 469.32 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-N-(3,3-difluorocyclopentyl)-2,6-naphthyridine-1,7-diamine.
| Compound Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-N-(3,3-difluorocyclopentyl)-2,6-naphthyridine-1,7-diamine |
|---|---|
| PubChem CID | 139395608 |
| Molecular Formula | C21H20Cl2F2N4O2 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-N-(3,3-difluorocyclopentyl)-2,6-naphthyridine-1,7-diamine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(N)cc3c(NC3CCC(F)(F)C3)n2)c1Cl |
| InChI | InChI=1S/C21H20Cl2F2N4O2/c1-30-14-7-15(31-2)19(23)17(18(14)22)13-5-10-9-27-16(26)6-12(10)20(29-13)28-11-3-4-21(24,25)8-11/h5-7,9,11H,3-4,8H2,1-2H3,(H2,26,27)(H,28,29) |
| InChIKey | UBPMLPUOVFXTFB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |