C23H26ClN5O3 — CID 139395843
N-[4-[[7-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]pyrrolidin-3-yl]formamide (PubChem CID 139395843) has the molecular formula C23H26ClN5O3 and a molecular weight of 455.95 g/mol. Its IUPAC name is N-[4-[[7-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]pyrrolidin-3-yl]formamide.
| Compound Name | N-[4-[[7-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]pyrrolidin-3-yl]formamide |
|---|---|
| PubChem CID | 139395843 |
| Molecular Formula | C23H26ClN5O3 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | N-[4-[[7-(2-chloro-6-ethyl-3,5-dimethoxyphenyl)-2,6-naphthyridin-3-yl]amino]pyrrolidin-3-yl]formamide |
| SMILES | CCc1c(OC)cc(OC)c(Cl)c1-c1cc2cnc(NC3CNCC3NC=O)cc2cn1 |
| InChI | InChI=1S/C23H26ClN5O3/c1-4-15-19(31-2)7-20(32-3)23(24)22(15)16-5-13-9-27-21(6-14(13)8-26-16)29-18-11-25-10-17(18)28-12-30/h5-9,12,17-18,25H,4,10-11H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | UXSLJQJNOXKIPD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|