C25H28N4O5 — CID 139395859
N-[4-[[3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-oxopyrano[4,3-c]pyridin-7-yl]amino]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 139395859) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is N-[4-[[3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-oxopyrano[4,3-c]pyridin-7-yl]amino]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[4-[[3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-oxopyrano[4,3-c]pyridin-7-yl]amino]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139395859 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[4-[[3-(3,5-dimethoxy-2,6-dimethylphenyl)-1-oxopyrano[4,3-c]pyridin-7-yl]amino]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CNCC1Nc1cc2c(=O)oc(-c3c(C)c(OC)cc(OC)c3C)cc2cn1 |
| InChI | InChI=1S/C25H28N4O5/c1-6-23(30)29-18-12-26-11-17(18)28-22-8-16-15(10-27-22)7-21(34-25(16)31)24-13(2)19(32-4)9-20(33-5)14(24)3/h6-10,17-18,26H,1,11-12H2,2-5H3,(H,27,28)(H,29,30) |
| InChIKey | ZUVRCMILIXXTNO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|