C18H19F2N5O3 — CID 139395868
6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-N-(2-methoxyethyl)pyrido[3,4-d]pyrimidine-2,8-diamine (PubChem CID 139395868) has the molecular formula C18H19F2N5O3 and a molecular weight of 391.38 g/mol. Its IUPAC name is 6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-N-(2-methoxyethyl)pyrido[3,4-d]pyrimidine-2,8-diamine.
| Compound Name | 6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-N-(2-methoxyethyl)pyrido[3,4-d]pyrimidine-2,8-diamine |
|---|---|
| PubChem CID | 139395868 |
| Molecular Formula | C18H19F2N5O3 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-N-(2-methoxyethyl)pyrido[3,4-d]pyrimidine-2,8-diamine |
| SMILES | COCCNc1nc(-c2c(F)c(OC)cc(OC)c2F)cc2cnc(N)nc12 |
| InChI | InChI=1S/C18H19F2N5O3/c1-26-5-4-22-17-16-9(8-23-18(21)25-16)6-10(24-17)13-14(19)11(27-2)7-12(28-3)15(13)20/h6-8H,4-5H2,1-3H3,(H,22,24)(H2,21,23,25) |
| InChIKey | WRDHLKJKKLQZDV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|