About 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine
7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine (PubChem CID 139396029) has the molecular formula C19H17ClFN3O
and a molecular weight of 357.82 g/mol. Its IUPAC name is 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine.
Molecular Properties
| Compound Name | 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine |
| PubChem CID | 139396029 |
| Molecular Formula | C19H17ClFN3O |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine |
| SMILES | Fc1ccccc1-c1cc2cnc(Cl)cc2c(NCC2CCCO2)n1 |
| InChI | InChI=1S/C19H17ClFN3O/c20-18-9-15-12(10-22-18)8-17(14-5-1-2-6-16(14)21)24-19(15)23-11-13-4-3-7-25-13/h1-2,5-6,8-10,13H,3-4,7,11H2,(H,23,24) |
| InChIKey | BOSNBAKWGKDGRY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine?
The IUPAC name of 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine (CID 139396029) is 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine.
What is the SMILES notation for 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine?
The canonical SMILES for 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine is Fc1ccccc1-c1cc2cnc(Cl)cc2c(NCC2CCCO2)n1.
What is the InChIKey of 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine?
The InChIKey is BOSNBAKWGKDGRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClFN3O/c20-18-9-15-12(10-22-18)8-17(14-5-1-2-6-16(14)21)24-19(15)23-11-13-4-3-7-25-13/h1-2,5-6,8-10,13H,3-4,7,11H2,(H,23,24).
What are the key properties of 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine?
7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine has a molecular weight of 357.82 g/mol, XLogP of 4.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3-(2-fluorophenyl)-N-(oxolan-2-ylmethyl)-2,6-naphthyridin-1-amine is sourced from PubChem (CID 139396029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).