About 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane
2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane (PubChem CID 139396447) has the molecular formula C15H28I2
and a molecular weight of 462.20 g/mol. Its IUPAC name is 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane.
Molecular Properties
| Compound Name | 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane |
| PubChem CID | 139396447 |
| Molecular Formula | C15H28I2 |
| Molecular Weight | 462.20 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane |
| SMILES | CCC(C)(I)C1CCC(C)(C)C1C(C)(I)CC |
| InChI | InChI=1S/C15H28I2/c1-7-14(5,16)11-9-10-13(3,4)12(11)15(6,17)8-2/h11-12H,7-10H2,1-6H3 |
| InChIKey | FGZZREFTAWVXFO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.20 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane?
The IUPAC name of 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane (CID 139396447) is 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane.
What is the SMILES notation for 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane?
The canonical SMILES for 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane is CCC(C)(I)C1CCC(C)(C)C1C(C)(I)CC.
What is the InChIKey of 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane?
The InChIKey is FGZZREFTAWVXFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28I2/c1-7-14(5,16)11-9-10-13(3,4)12(11)15(6,17)8-2/h11-12H,7-10H2,1-6H3.
What are the key properties of 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane?
2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane has a molecular weight of 462.20 g/mol, XLogP of 6.25, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(2-iodobutan-2-yl)-1,1-dimethylcyclopentane is sourced from PubChem (CID 139396447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).