C46H29N5 — CID 139396505
9-phenyl-5-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-10,15-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1,3,5,7,9,11,13-heptaene (PubChem CID 139396505) has the molecular formula C46H29N5 and a molecular weight of 651.77 g/mol. Its IUPAC name is 9-phenyl-5-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-10,15-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 9-phenyl-5-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-10,15-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 139396505 |
| Molecular Formula | C46H29N5 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.24 |
| IUPAC Name | 9-phenyl-5-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-10,15-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1,3,5,7,9,11,13-heptaene |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccc6c(c5)c5c(-c7ccccc7)nc7cccc6n75)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C46H29N5/c1-4-11-30(12-5-1)31-19-23-35(24-20-31)45-48-44(34-15-8-3-9-16-34)49-46(50-45)36-25-21-32(22-26-36)37-27-28-38-39(29-37)43-42(33-13-6-2-7-14-33)47-41-18-10-17-40(38)51(41)43/h1-29H |
| InChIKey | XMUUGVSCPICDIC-UHFFFAOYSA-N |
| XLogP | 11.27 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |