C32H34FN3O3 — CID 139397025
6-(2,1,3-benzoxadiazol-5-yl)-5-[4-[(3S)-1-(3-fluoropropyl)piperidin-3-yl]oxycyclohepta-1,3,6-trien-1-yl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 139397025) has the molecular formula C32H34FN3O3 and a molecular weight of 527.64 g/mol. Its IUPAC name is 6-(2,1,3-benzoxadiazol-5-yl)-5-[4-[(3S)-1-(3-fluoropropyl)piperidin-3-yl]oxycyclohepta-1,3,6-trien-1-yl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(2,1,3-benzoxadiazol-5-yl)-5-[4-[(3S)-1-(3-fluoropropyl)piperidin-3-yl]oxycyclohepta-1,3,6-trien-1-yl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 139397025 |
| Molecular Formula | C32H34FN3O3 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | 6-(2,1,3-benzoxadiazol-5-yl)-5-[4-[(3S)-1-(3-fluoropropyl)piperidin-3-yl]oxycyclohepta-1,3,6-trien-1-yl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | Oc1ccc2c(c1)CCCC(c1ccc3nonc3c1)=C2C1=CC=C(O[C@H]2CCCN(CCCF)C2)CC=C1 |
| InChI | InChI=1S/C32H34FN3O3/c33-16-4-18-36-17-3-8-27(21-36)38-26-7-1-5-22(10-13-26)32-28(24-11-15-30-31(20-24)35-39-34-30)9-2-6-23-19-25(37)12-14-29(23)32/h1,5,10-15,19-20,27,37H,2-4,6-9,16-18,21H2/t27-/m0/s1 |
| InChIKey | HFDNBUIDCKXUMB-MHZLTWQESA-N |
| XLogP | 6.79 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|