C24H46O3 — CID 139397500
4-[3-(2,2-diethylpentoxy)-3-ethylpentoxy]-4-ethylhex-1-en-3-one (PubChem CID 139397500) has the molecular formula C24H46O3 and a molecular weight of 382.63 g/mol. Its IUPAC name is 4-[3-(2,2-diethylpentoxy)-3-ethylpentoxy]-4-ethylhex-1-en-3-one.
| Compound Name | 4-[3-(2,2-diethylpentoxy)-3-ethylpentoxy]-4-ethylhex-1-en-3-one |
|---|---|
| PubChem CID | 139397500 |
| Molecular Formula | C24H46O3 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 382.34 |
| IUPAC Name | 4-[3-(2,2-diethylpentoxy)-3-ethylpentoxy]-4-ethylhex-1-en-3-one |
| SMILES | C=CC(=O)C(CC)(CC)OCCC(CC)(CC)OCC(CC)(CC)CCC |
| InChI | InChI=1S/C24H46O3/c1-9-17-22(11-3,12-4)20-27-23(13-5,14-6)18-19-26-24(15-7,16-8)21(25)10-2/h10H,2,9,11-20H2,1,3-8H3 |
| InChIKey | JCMRKCBGRGOLOR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|