About (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine
(E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine (PubChem CID 139397517) has the molecular formula C10H10F3NO
and a molecular weight of 217.19 g/mol. Its IUPAC name is (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine.
Molecular Properties
| Compound Name | (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine |
| PubChem CID | 139397517 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine |
| SMILES | N/C=C/C1=CCC(OC(F)(F)F)=CC=C1 |
| InChI | InChI=1S/C10H10F3NO/c11-10(12,13)15-9-3-1-2-8(4-5-9)6-7-14/h1-4,6-7H,5,14H2/b7-6+ |
| InChIKey | XJDJCADTZFDGPT-VOTSOKGWSA-N |
| XLogP | 2.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine?
The IUPAC name of (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine (CID 139397517) is (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine.
What is the SMILES notation for (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine?
The canonical SMILES for (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine is N/C=C/C1=CCC(OC(F)(F)F)=CC=C1.
What is the InChIKey of (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine?
The InChIKey is XJDJCADTZFDGPT-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H10F3NO/c11-10(12,13)15-9-3-1-2-8(4-5-9)6-7-14/h1-4,6-7H,5,14H2/b7-6+.
What are the key properties of (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine?
(E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine has a molecular weight of 217.19 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-[4-(trifluoromethoxy)cyclohepta-1,4,6-trien-1-yl]ethenamine is sourced from PubChem (CID 139397517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).